3-(3,4-Difluorophenyl)propanamide

• Catalog Number: ACMA00001024
• Category: Amines
• Molecular Weight: 185.17
• Molecular Formula: C₁₂H₁₃N
• Hazard Statements: H315-H319-H335
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C9H9F2NO.

What is the molecular weight of the compound?

The molecular weight of the compound is 185.17 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 3-(3,4-difluorophenyl)propanamide.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C9H9F2NO/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1,3,5H,2,4H2,(H2,12,13).

What is the InChIKey of the compound?

The InChIKey of the compound is XZQRRQRBAHSJDP-UHFFFAOYSA-N.

What is the CAS number of the compound?

The CAS number of the compound is 1098350-17-4.

What is the European Community (EC) number of the compound?

The European Community (EC) number of the compound is 822-501-0.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 1.2.

How many hydrogen bond donor counts does the compound have?

The compound has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does the compound have?

The compound has 3 hydrogen bond acceptor counts.