3-[(2-Chloro-4-fluorobenzyl)oxy]benzaldehyde

• Catalog Number: ACMA00002483
• Category: Ethers
• Molecular Weight: 264.68
• Molecular Formula: C₁₄H₉BrF₄O
• Hazard Statements: H317
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C14H10ClFO2.

What are the synonyms for the compound?

The synonyms for the compound are 3-[(2-chloro-4-fluorobenzyl)oxy]benzaldehyde, 588681-49-6, and 3-[(2-chloro-4-fluorophenyl)methoxy]benzaldehyde.

What is the molecular weight of the compound?

The molecular weight of the compound is 264.68 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 3-[(2-chloro-4-fluorophenyl)methoxy]benzaldehyde.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C14H10ClFO2/c15-14-7-12(16)5-4-11(14)9-18-13-3-1-2-10(6-13)8-17/h1-8H,9H2.

What is the InChIKey of the compound?

The InChIKey of the compound is LBATYTBQYKAONS-UHFFFAOYSA-N.

What is the Canonical SMILES of the compound?

The Canonical SMILES of the compound is C1=CC(=CC(=C1)OCC2=C(C=C(C=C2)F)Cl)C=O.

What is the XLogP3 value of the compound?

The XLogP3 value of the compound is 3.8.

How many hydrogen bond donor counts does the compound have?

The compound has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does the compound have?

The compound has 3 hydrogen bond acceptor counts.