--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C14H10ClFO2.
The synonyms for the compound are 3-[(2-chloro-4-fluorobenzyl)oxy]benzaldehyde, 588681-49-6, and 3-[(2-chloro-4-fluorophenyl)methoxy]benzaldehyde.
The molecular weight of the compound is 264.68 g/mol.
The IUPAC name of the compound is 3-[(2-chloro-4-fluorophenyl)methoxy]benzaldehyde.
The InChI of the compound is InChI=1S/C14H10ClFO2/c15-14-7-12(16)5-4-11(14)9-18-13-3-1-2-10(6-13)8-17/h1-8H,9H2.
The InChIKey of the compound is LBATYTBQYKAONS-UHFFFAOYSA-N.
The Canonical SMILES of the compound is C1=CC(=CC(=C1)OCC2=C(C=C(C=C2)F)Cl)C=O.
The XLogP3 value of the compound is 3.8.
The compound has 0 hydrogen bond donor counts.
The compound has 3 hydrogen bond acceptor counts.
[Other Products] Fluorphlogopite(Mg3K[AlF2O(SiO3)3]) Catalog: ACM12003382 CAS: 12003-38-2 |