3-(2-Aminophenyl)-1,3-oxazolidin-2-one

• Catalog Number: ACMA00000846
• Category: Amines
• Molecular Weight: 178.19
• Molecular Formula: C₁₀H₁₃N₃O₂
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C9H10N2O2.

What is the molecular weight of the compound?

The molecular weight of the compound is 178.19 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 3-(2-aminophenyl)-1,3-oxazolidin-2-one.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C9H10N2O2/c10-7-3-1-2-4-8(7)11-5-6-13-9(11)12/h1-4H,5-6,10H2.

What is the InChIKey of the compound?

The InChIKey of the compound is DXRJOYLGTIOAHA-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is C1COC(=O)N1C2=CC=CC=C2N.

What is the CAS number of the compound?

The CAS number of the compound is 936940-54-4.

What is the European Community (EC) number of the compound?

The European Community (EC) number of the compound is 852-984-3.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 0.8.

Is the compound a canonicalized compound?

Yes, the compound is canonicalized.