3-(2-Aminoethyl)-1,3-oxazolidin-2-one hydrochloride

• Catalog Number: ACMA00001231
• Category: Amines
• Molecular Weight: 166.61
• Molecular Formula: C₅H₁₀Cl₂N₂S
• Hazard Statements: H301
• RIDADR: NONH for all modes of transport
• Symbol: GHS06

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C5H11ClN2O2.

What are the synonyms of the compound?

The synonyms of the compound are 1262773-49-8, 3-(2-Aminoethyl)-1,3-oxazolidin-2-one hydrochloride, 3-(2-Aminoethyl)oxazolidin-2-one hydrochloride, and 2-Oxazolidinone, 3-(2-aminoethyl)-, hydrochloride (1:1).

What is the molecular weight of the compound?

The molecular weight of the compound is 166.6 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 3-(2-aminoethyl)-1,3-oxazolidin-2-one;hydrochloride.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C5H10N2O2.ClH/c6-1-2-7-3-4-9-5(7)8;/h1-4,6H2;1H.

What is the InChIKey of the compound?

The InChIKey of the compound is NOUSUYADGXGEPS-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is C1COC(=O)N1CCN.Cl.

What is the CAS number of the compound?

The CAS number of the compound is 1262773-49-8.

What is the European Community number of the compound?

The European Community number of the compound is 873-737-6.

What is the hydrogen bond donor count of the compound?

The hydrogen bond donor count of the compound is 2.