3-(2,6-Dichlorophenyl)-5-methylisoxazole-4-carbonyl chloride

• CAS: 4462-55-9
• Catalog Number: ACM4462559
• Category: Other Products
• Molecular Weight: 290.53
• Molecular Formula: C₁₁H₆Cl₃NO₂
• Synonyms: 3-(2,6-dichlorophenyl)-5-methyl-4-isoxazolecarbonylchlorid;3-(2,6-DICHLOROPHENYL)-5-METHYLISOXAZOLE-4-CARBONYL CHLORIDE;3-(2,6-Dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride;3-(2,6-DICHLOROPHENYL)-5-METHYL-4-CHLOROCARBONYL ISOXAZOLE;3-(2,6-DICHLOROPHENYL)-5-METHYL-4-ISOXAZOLE-CARBONYL CHLORIDE;3-(2,6-Dichlorophenyl)-5-methyl-3-phenyl-4-chlorocarbonylisoxazole;DICHLOROPHENYL-5-METHYLISOXAZOLE-4-CARBONYLCHLORIDE;3-(2,6-Dichlorophenyl)-5-Methyl-4-Carbonylisoxazolechloride
• Melting Point: 92°C
• Hazard Statements: C
• Safety Description: 26-36/37/39-45-36/37/39/45

Custom Q&A

What is the chemical formula of the compound?

The chemical formula of the compound is C11H6Cl3NO2.

What is the molecular weight of the compound?

The molecular weight of the compound is 290.5 g/mol.

What are the synonyms of the compound?

The synonyms of the compound are 4462-55-9, 3-(2,6-Dichlorophenyl)-5-methylisoxazole-4-carbonyl chloride, Dcimc chloride, 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride.

What is the InChIKey of the compound?

The InChIKey of the compound is IZQGELJKDARDMZ-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CC1=C(C(=NO1)C2=C(C=CC=C2Cl)Cl)C(=O)Cl.

What is the CAS number of the compound?

The CAS number of the compound is 4462-55-9.

What is the UNII of the compound?

The UNII of the compound is PB71YVH5F2.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 4.2.

What is the hydrogen bond acceptor count of the compound?

The hydrogen bond acceptor count of the compound is 3.