3-(2,4-Dimethoxy-phenyl)-3-oxo-propionic acid methyl ester

• Catalog Number: ACMA00002263
• Category: Ethers
• Molecular Weight: 238.24
• Molecular Formula: C₁₂H₁₄O₅
• Hazard Statements: H302-H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C12H14O5.

What are some synonyms of the compound?

Some synonyms of the compound are:
676348-64-4
methyl 3-(2,4-dimethoxyphenyl)-3-oxopropanoate
3-(2,4-Dimethoxy-phenyl)-3-oxo-propionic acid methyl ester
3-(2,4-dimethoxyphenyl)-3-oxo-propionic acidmethyl ester

What is the molecular weight of the compound?

The molecular weight of the compound is 238.24 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is methyl 3-(2,4-dimethoxyphenyl)-3-oxopropanoate.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C12H14O5/c1-15-8-4-5-9(11(6-8)16-2)10(13)7-12(14)17-3/h4-6H,7H2,1-3H3.

What is the InChIKey of the compound?

The InChIKey of the compound is KYIVDZUWNQZWOH-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is COC1=CC(=C(C=C1)C(=O)CC(=O)OC)OC.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 1.6.

How many hydrogen bond donor counts does the compound have?

The compound has 0 hydrogen bond donor count.

How many hydrogen bond acceptor counts does the compound have?

The compound has 5 hydrogen bond acceptor count.