2-(tert-Butoxycarbonyl)-2,7-diazaspiro[3.5]nonane

• Catalog Number: ACMA00002216
• Category: Ethers
• Molecular Weight: 226.32
• Molecular Formula: C₁₂H₁₉NO₃S
• Hazard Statements: H302-H319
• RIDADR: UN 3077 9 / PGIII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C12H22N2O2.

What is the molecular weight of the compound?

The molecular weight of the compound is 226.32 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is tert-butyl 2,7-diazaspiro[3.5]nonane-2-carboxylate.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C12H22N2O2/c1-11(2,3)16-10(15)14-8-12(9-14)4-6-13-7-5-12/h13H,4-9H2,1-3H3.

What is the InChIKey of the compound?

The InChIKey of the compound is HWLNKJXLGQVMJH-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CC(C)(C)OC(=O)N1CC2(C1)CCNCC2.

What is the CAS number of the compound?

The CAS number of the compound is 236406-55-6.

What is the EC number of the compound?

The EC number of the compound is 803-504-6.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 1.1.

Is the compound canonicalized?

Yes, the compound is canonicalized.