[2-(Phenoxymethyl)phenyl]methanol

• Catalog Number: ACMA00002439
• Category: Ethers
• Molecular Weight: 214.26
• Molecular Formula: C₁₄H₁₄N₂O₅S
• Hazard Statements: H302
• RIDADR: UN 3077 9 / PGIII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of [2-(Phenoxymethyl)phenyl]methanol?

The molecular formula is C14H14O2.

What is the molecular weight of [2-(Phenoxymethyl)phenyl]methanol?

The molecular weight is 214.26 g/mol.

What is the IUPAC name of [2-(Phenoxymethyl)phenyl]methanol?

The IUPAC name is [2-(phenoxymethyl)phenyl]methanol.

What is the InChI of [2-(Phenoxymethyl)phenyl]methanol?

The InChI is InChI=1S/C14H14O2/c15-10-12-6-4-5-7-13(12)11-16-14-8-2-1-3-9-14/h1-9,15H,10-11H2.

What is the InChIKey of [2-(Phenoxymethyl)phenyl]methanol?

The InChIKey is RMRTWBZKENSMCI-UHFFFAOYSA-N.

What is the canonical SMILES of [2-(Phenoxymethyl)phenyl]methanol?

The canonical SMILES is C1=CC=C(C=C1)OCC2=CC=CC=C2CO.

What is the CAS number of [2-(Phenoxymethyl)phenyl]methanol?

The CAS number is 34904-98-8.

What is the XLogP3-AA value of [2-(Phenoxymethyl)phenyl]methanol?

The XLogP3-AA value is 2.5.

How many hydrogen bond donor count does [2-(Phenoxymethyl)phenyl]methanol have?

[2-(Phenoxymethyl)phenyl]methanol has 1 hydrogen bond donor count.

How many rotatable bond count does [2-(Phenoxymethyl)phenyl]methanol have?

[2-(Phenoxymethyl)phenyl]methanol has 4 rotatable bond count.