922718-55-6 Purity
97+%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 2-Morpholinophenylboronic acid is C10H14BNO3.
The molecular weight of 2-Morpholinophenylboronic acid is 207.04 g/mol.
The IUPAC name of 2-Morpholinophenylboronic acid is (2-morpholin-4-ylphenyl)boronic acid.
The InChI code of 2-Morpholinophenylboronic acid is InChI=1S/C10H14BNO3/c13-11(14)9-3-1-2-4-10(9)12-5-7-15-8-6-12/h1-4,13-14H,5-8H2.
The InChIKey of 2-Morpholinophenylboronic acid is ICRHNMKDEVGGGH-UHFFFAOYSA-N.
The canonical SMILES of 2-Morpholinophenylboronic acid is B(C1=CC=CC=C1N2CCOCC2)(O)O.
The CAS number of 2-Morpholinophenylboronic acid is 933052-52-9.
The hydrogen bond donor count of 2-Morpholinophenylboronic acid is 2.
The hydrogen bond acceptor count of 2-Morpholinophenylboronic acid is 4.
Yes, 2-Morpholinophenylboronic acid is in the canonicalized form.