2-Methyl-1,3-dioxolane-2-carboxylic acid

• Catalog Number: ACMA00003020
• Category: Ortho Esters
• Molecular Weight: 132.11
• Molecular Formula: C₄H₇BrO₂
• Hazard Statements: H225-H302 + H312 + H332
• RIDADR: UN 3272 3 / PGII
• Symbol: GHS02

Custom Q&A

What is the molecular formula of 2-Methyl-1,3-dioxolane-2-carboxylic acid?

The molecular formula is C5H8O4.

How much does 2-Methyl-1,3-dioxolane-2-carboxylic acid weigh?

It has a molecular weight of 132.11 g/mol.

What is the IUPAC name of 2-Methyl-1,3-dioxolane-2-carboxylic acid?

The IUPAC name is 2-methyl-1,3-dioxolane-2-carboxylic acid.

What is the InChI code of 2-Methyl-1,3-dioxolane-2-carboxylic acid?

The InChI code is InChI=1S/C5H8O4/c1-5(4(6)7)8-2-3-9-5/h2-3H2,1H3,(H,6,7).

What is the InChIKey of 2-Methyl-1,3-dioxolane-2-carboxylic acid?

The InChIKey is ZHGDCOBQAGUTIW-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Methyl-1,3-dioxolane-2-carboxylic acid?

The canonical SMILES is CC1(OCCO1)C(=O)O.

What is the CAS number of 2-Methyl-1,3-dioxolane-2-carboxylic acid?

The CAS number is 5736-04-9.

How many hydrogen bond donor counts does 2-Methyl-1,3-dioxolane-2-carboxylic acid have?

It has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 2-Methyl-1,3-dioxolane-2-carboxylic acid have?

It has 4 hydrogen bond acceptor counts.

Is 2-Methyl-1,3-dioxolane-2-carboxylic acid considered as a canonicalized compound?

Yes, it is considered a canonicalized compound.