CAS
1003-99-2 Purity
98%
1003-99-2 Purity
98%
Inquiry Basket
2-Methoxybenzyl bromide
CAS
52289-93-7
Catalog Number
ACM52289937
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Methoxybenzyl bromide?
The molecular formula of 2-Methoxybenzyl bromide is C8H9BrO.
What is the molecular weight of 2-Methoxybenzyl bromide?
The molecular weight of 2-Methoxybenzyl bromide is 201.06 g/mol.
What is the IUPAC name of 2-Methoxybenzyl bromide?
The IUPAC name of 2-Methoxybenzyl bromide is 1-(bromomethyl)-2-methoxybenzene.
What is the InChI of 2-Methoxybenzyl bromide?
The InChI of 2-Methoxybenzyl bromide is InChI=1S/C8H9BrO/c1-10-8-5-3-2-4-7(8)6-9/h2-5H,6H2,1H3.
What is the InChIKey of 2-Methoxybenzyl bromide?
The InChIKey of 2-Methoxybenzyl bromide is WAUNFWSVXRPCDQ-UHFFFAOYSA-N.
What is the canonical SMILES representation of 2-Methoxybenzyl bromide?
The canonical SMILES representation of 2-Methoxybenzyl bromide is COC1=CC=CC=C1CBr.
What is the CAS number of 2-Methoxybenzyl bromide?
The CAS number of 2-Methoxybenzyl bromide is 52289-93-7.
What is the XLogP3 value of 2-Methoxybenzyl bromide?
The XLogP3 value of 2-Methoxybenzyl bromide is 2.6.
How many hydrogen bond donor counts does 2-Methoxybenzyl bromide have?
2-Methoxybenzyl bromide has 0 hydrogen bond donor counts.
How many rotatable bond counts does 2-Methoxybenzyl bromide have?
2-Methoxybenzyl bromide has 2 rotatable bond counts.
Recommended Products
