CAS
--- Purity
---
--- Purity
---
Inquiry Basket
2-Hydroxybicyclo[3.2.1]octane-6-carboxylic acid
Catalog Number
ACMA00000494
Category
Alcohols
Molecular Weight
170.21
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H302
RIDADR
NONH for all modes of transport
Symbol
GHS07
What is the molecular formula of 2-Hydroxybicyclo[3.2.1]octane-6-carboxylic acid?
The molecular formula of 2-Hydroxybicyclo[3.2.1]octane-6-carboxylic acid is C9H14O3.
What is the molecular weight of 2-Hydroxybicyclo[3.2.1]octane-6-carboxylic acid?
The molecular weight of 2-Hydroxybicyclo[3.2.1]octane-6-carboxylic acid is 170.21 g/mol.
What is the IUPAC name of 2-Hydroxybicyclo[3.2.1]octane-6-carboxylic acid?
The IUPAC name of 2-Hydroxybicyclo[3.2.1]octane-6-carboxylic acid is 2-hydroxybicyclo[3.2.1]octane-6-carboxylic acid.
What is the InChI of 2-Hydroxybicyclo[3.2.1]octane-6-carboxylic acid?
The InChI of 2-Hydroxybicyclo[3.2.1]octane-6-carboxylic acid is InChI=1S/C9H14O3/c10-8-2-1-5-3-6(8)4-7(5)9(11)12/h5-8,10H,1-4H2,(H,11,12).
What is the InChIKey of 2-Hydroxybicyclo[3.2.1]octane-6-carboxylic acid?
The InChIKey of 2-Hydroxybicyclo[3.2.1]octane-6-carboxylic acid is FSQSHXLJRFYYMV-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Hydroxybicyclo[3.2.1]octane-6-carboxylic acid?
The canonical SMILES of 2-Hydroxybicyclo[3.2.1]octane-6-carboxylic acid is C1CC(C2CC1C(C2)C(=O)O).
What is the CAS number of 2-Hydroxybicyclo[3.2.1]octane-6-carboxylic acid?
The CAS number of 2-Hydroxybicyclo[3.2.1]octane-6-carboxylic acid is 257932-29-9.
What is the hydrogen bond donor count of 2-Hydroxybicyclo[3.2.1]octane-6-carboxylic acid?
The hydrogen bond donor count of 2-Hydroxybicyclo[3.2.1]octane-6-carboxylic acid is 2.
What is the hydrogen bond acceptor count of 2-Hydroxybicyclo[3.2.1]octane-6-carboxylic acid?
The hydrogen bond acceptor count of 2-Hydroxybicyclo[3.2.1]octane-6-carboxylic acid is 3.
What is the rotatable bond count of 2-Hydroxybicyclo[3.2.1]octane-6-carboxylic acid?
The rotatable bond count of 2-Hydroxybicyclo[3.2.1]octane-6-carboxylic acid is 1.
Recommended Products
