2-Fluoro-4,5-dimethoxyphenylboronic acid

• CAS: 900175-07-7
• Catalog Number: ACM900175077
• Category: Boronic Acids

Custom Q&A

What is the molecular formula of 2-Fluoro-4,5-dimethoxyphenylboronic acid?

The molecular formula of 2-Fluoro-4,5-dimethoxyphenylboronic acid is C8H10BFO4.

What is the molecular weight of 2-Fluoro-4,5-dimethoxyphenylboronic acid?

The molecular weight of 2-Fluoro-4,5-dimethoxyphenylboronic acid is 199.97 g/mol.

What is the IUPAC name of 2-Fluoro-4,5-dimethoxyphenylboronic acid?

The IUPAC name of 2-Fluoro-4,5-dimethoxyphenylboronic acid is (2-fluoro-4,5-dimethoxyphenyl)boronic acid.

What is the InChI of 2-Fluoro-4,5-dimethoxyphenylboronic acid?

The InChI of 2-Fluoro-4,5-dimethoxyphenylboronic acid is InChI=1S/C8H10BFO4/c1-13-7-3-5(9(11)12)6(10)4-8(7)14-2/h3-4,11-12H,1-2H3.

What is the InChIKey of 2-Fluoro-4,5-dimethoxyphenylboronic acid?

The InChIKey of 2-Fluoro-4,5-dimethoxyphenylboronic acid is ZXESUNZYCLCARB-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Fluoro-4,5-dimethoxyphenylboronic acid?

The canonical SMILES of 2-Fluoro-4,5-dimethoxyphenylboronic acid is B(C1=CC(=C(C=C1F)OC)OC)(O)O.

What is the CAS number of 2-Fluoro-4,5-dimethoxyphenylboronic acid?

The CAS number of 2-Fluoro-4,5-dimethoxyphenylboronic acid is 900175-07-7.

What is the hydrogen bond donor count of 2-Fluoro-4,5-dimethoxyphenylboronic acid?

The hydrogen bond donor count of 2-Fluoro-4,5-dimethoxyphenylboronic acid is 2.

What is the hydrogen bond acceptor count of 2-Fluoro-4,5-dimethoxyphenylboronic acid?

The hydrogen bond acceptor count of 2-Fluoro-4,5-dimethoxyphenylboronic acid is 5.

What is the topological polar surface area of 2-Fluoro-4,5-dimethoxyphenylboronic acid?

The topological polar surface area of 2-Fluoro-4,5-dimethoxyphenylboronic acid is 58.9Ų.