2-Fluoro-3-(trifluoromethyl)benzyl bromide

• CAS: 184970-25-0
• Catalog Number: ACM184970250
• Category: Bromine Series
• Molecular Weight: 257.02
• Molecular Formula: C₆H₂Cl₃FO₂S
• Hazard Statements: H302-H410
• RIDADR: UN 1759 8 / PGIII
• Symbol: GHS07

Custom Q&A

What is the PubChem CID for 2-Fluoro-3-(trifluoromethyl)benzyl bromide?

PubChem CID 2737569.

What is the molecular formula of 2-Fluoro-3-(trifluoromethyl)benzyl bromide?

The molecular formula is C8H5BrF4.

What is the molecular weight of 2-Fluoro-3-(trifluoromethyl)benzyl bromide?

The molecular weight is 257.02 g/mol.

What is the IUPAC name of 2-Fluoro-3-(trifluoromethyl)benzyl bromide?

The IUPAC name is 1-(bromomethyl)-2-fluoro-3-(trifluoromethyl)benzene.

What is the Canonical SMILES of 2-Fluoro-3-(trifluoromethyl)benzyl bromide?

The Canonical SMILES is C1=CC(=C(C(=C1)C(F)(F)F)F)CBr.

What is the CAS number of 2-Fluoro-3-(trifluoromethyl)benzyl bromide?

The CAS number is 184970-25-0.

What is the European Community (EC) number of 2-Fluoro-3-(trifluoromethyl)benzyl bromide?

The EC number is 623-907-9.

What is the hydrogen bond donor count of 2-Fluoro-3-(trifluoromethyl)benzyl bromide?

The hydrogen bond donor count is 0.

What is the hydrogen bond acceptor count of 2-Fluoro-3-(trifluoromethyl)benzyl bromide?

The hydrogen bond acceptor count is 4.

Is 2-Fluoro-3-(trifluoromethyl)benzyl bromide considered canonicalized?

Yes, it is considered canonicalized.