CAS
821-06-7 Purity
98%
821-06-7 Purity
98%
Inquiry Basket
2-Fluoro-3-nitrobenzyl bromide
CAS
946125-65-1
Catalog Number
ACM946125651
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Fluoro-3-nitrobenzyl bromide?
The molecular formula of 2-Fluoro-3-nitrobenzyl bromide is C7H5BrFNO2.
What is the molecular weight of 2-Fluoro-3-nitrobenzyl bromide?
The molecular weight of 2-Fluoro-3-nitrobenzyl bromide is 234.02 g/mol.
What is the IUPAC name of 2-Fluoro-3-nitrobenzyl bromide?
The IUPAC name of 2-Fluoro-3-nitrobenzyl bromide is 1-(bromomethyl)-2-fluoro-3-nitrobenzene.
What is the InChI of 2-Fluoro-3-nitrobenzyl bromide?
The InChI of 2-Fluoro-3-nitrobenzyl bromide is InChI=1S/C7H5BrFNO2/c8-4-5-2-1-3-6(7(5)9)10(11)12/h1-3H,4H2.
What is the InChIKey of 2-Fluoro-3-nitrobenzyl bromide?
The InChIKey of 2-Fluoro-3-nitrobenzyl bromide is MIESICVJNXXYKC-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Fluoro-3-nitrobenzyl bromide?
The canonical SMILES of 2-Fluoro-3-nitrobenzyl bromide is C1=CC(=C(C(=C1)[N+](=O)[O-])F)CBr.
What is the CAS number of 2-Fluoro-3-nitrobenzyl bromide?
The CAS number of 2-Fluoro-3-nitrobenzyl bromide is 946125-65-1.
What is the XLogP3-AA value of 2-Fluoro-3-nitrobenzyl bromide?
The XLogP3-AA value of 2-Fluoro-3-nitrobenzyl bromide is 2.4.
How many hydrogen bond donor counts does 2-Fluoro-3-nitrobenzyl bromide have?
2-Fluoro-3-nitrobenzyl bromide has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2-Fluoro-3-nitrobenzyl bromide have?
2-Fluoro-3-nitrobenzyl bromide has 3 hydrogen bond acceptor counts.
Recommended Products
