2-(Ethyloxy)-4-formylphenyl 4-fluorobenzoate

• Catalog Number: ACMA00002997
• Category: Ethers
• Molecular Weight: 288.27
• Molecular Formula: C₇H₁₅N₃O₃
• Hazard Statements: H226-H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS02

Custom Q&A

What is the molecular formula of the compound?

The molecular formula is C16H13FO4.

What are the synonyms of the compound?

The synonyms are 2-ethoxy-4-formylphenyl 4-fluorobenzoate, 301353-33-3, (2-ethoxy-4-formylphenyl) 4-fluorobenzoate, 2-(ethyloxy)-4-formylphenyl 4-fluorobenzoate, Oprea1_096812.

What is the molecular weight of the compound?

The molecular weight is 288.27 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is (2-ethoxy-4-formylphenyl) 4-fluorobenzoate.

What is the InChI of the compound?

The InChI is InChI=1S/C16H13FO4/c1-2-20-15-9-11(10-18)3-8-14(15)21-16(19)12-4-6-13(17)7-5-12/h3-10H,2H2,1H3.

What is the InChIKey of the compound?

The InChIKey is RZFICDFJHRQCPM-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES is CCOC1=C(C=CC(=C1)C=O)OC(=O)C2=CC=C(C=C2)F.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value is 3.2.

How many hydrogen bond donor counts does the compound have?

The compound has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does the compound have?

The compound has 5 hydrogen bond acceptor counts.