--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 2-ethoxy-6-fluorobenzonitrile.
The molecular formula of the compound is C9H8FNO.
The molecular weight of the compound is 165.16 g/mol.
The InChI of the compound is InChI=1S/C9H8FNO/c1-2-12-9-5-3-4-8(10)7(9)6-11/h3-5H,2H2,1H3.
The InChIKey of the compound is HVAKERNUWAPZOR-UHFFFAOYSA-N.
The canonical SMILES of the compound is CCOC1=C(C(=CC=C1)F)C#N.
The CAS number of the compound is 119584-73-5.
The XLogP3-AA value of the compound is 2.1.
The hydrogen bond donor count of the compound is 0.
Yes, the compound is canonicalized.