2-Chloro-5-fluoropyridine-3-boronicacid

• CAS: 913373-43-0
• Catalog Number: ACM913373430
• Category: Boro-Amino Acids
• Molecular Weight: 175.3532
• Molecular Formula: C₅H₄BClFNO₂

Custom Q&A

What is the molecular formula of 2-Chloro-5-fluoropyridine-3-boronic acid?

The molecular formula is C5H4BClFNO2.

What is the molecular weight of 2-Chloro-5-fluoropyridine-3-boronic acid?

The molecular weight is 175.35 g/mol.

What is the IUPAC name of 2-Chloro-5-fluoropyridine-3-boronic acid?

The IUPAC name is (2-chloro-5-fluoropyridin-3-yl)boronic acid.

What is the InChI of 2-Chloro-5-fluoropyridine-3-boronic acid?

The InChI is InChI=1S/C5H4BClFNO2/c7-5-4(6(10)11)1-3(8)2-9-5/h1-2,10-11H.

What is the InChIKey of 2-Chloro-5-fluoropyridine-3-boronic acid?

The InChIKey is DRMCJBKKTDFORC-UHFFFAOYSA-N.

What is the computed canonical SMILES of 2-Chloro-5-fluoropyridine-3-boronic acid?

The canonical SMILES is B(C1=CC(=CN=C1Cl)F)(O)O.

What is the CAS number of 2-Chloro-5-fluoropyridine-3-boronic acid?

The CAS number is 913373-43-0.

How many hydrogen bond donor counts does 2-Chloro-5-fluoropyridine-3-boronic acid have?

It has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 2-Chloro-5-fluoropyridine-3-boronic acid have?

It has 4 hydrogen bond acceptor counts.

How many rotatable bond counts does 2-Chloro-5-fluoropyridine-3-boronic acid have?

It has 1 rotatable bond count.