2-Chloro-3-fluoroisonicotinaldehyde hydrate

• CAS: 1196156-07-6
• Catalog Number: ACM1196156076
• Category: Pyridines
• Molecular Weight: 177.6
• Molecular Formula: C6H3ClFNO·H₂O

Custom Q&A

What is the PubChem CID for 2-Chloro-3-fluoroisonicotinaldehyde hydrate?

PubChem CID 45933765.

What is the molecular formula of 2-Chloro-3-fluoroisonicotinaldehyde hydrate?

The molecular formula is C6H5ClFNO2.

What are the synonyms for 2-Chloro-3-fluoroisonicotinaldehyde hydrate?

The synonyms include 1196156-07-6, 2-CHLORO-3-FLUORO-4-FORMYLPYRIDINE HYDRATE, 2-chloro-3-fluoropyridine-4-carbaldehyde;hydrate, and SCHEMBL13275515.

What is the molecular weight of 2-Chloro-3-fluoroisonicotinaldehyde hydrate?

The molecular weight is 177.56 g/mol.

What is the parent compound of 2-Chloro-3-fluoroisonicotinaldehyde hydrate?

The parent compound is CID 2763160 (2-Chloro-3-fluoro-4-formylpyridine).

What are the component compounds of 2-Chloro-3-fluoroisonicotinaldehyde hydrate?

The component compounds are CID 2763160 (2-Chloro-3-fluoro-4-formylpyridine) and CID 962 (Water).

What is the IUPAC name of 2-Chloro-3-fluoroisonicotinaldehyde hydrate?

The IUPAC name is 2-chloro-3-fluoropyridine-4-carbaldehyde;hydrate.

What is the InChI of 2-Chloro-3-fluoroisonicotinaldehyde hydrate?

The InChI is InChI=1S/C6H3ClFNO.H2O/c7-6-5(8)4(3-10)1-2-9-6;/h1-3H;1H2.

What is the InChIKey of 2-Chloro-3-fluoroisonicotinaldehyde hydrate?

The InChIKey is HLMKXEOYZMLNJQ-UHFFFAOYSA-N.

What are some computed properties of 2-Chloro-3-fluoroisonicotinaldehyde hydrate?

Some computed properties include molecular weight, hydrogen bond donor count, hydrogen bond acceptor count, rotatable bond count, exact mass, monoisotopic mass, topological polar surface area, heavy atom count, formal charge, complexity, isotope atom count, defined atom stereocenter count, undefined atom stereocenter count, defined bond stereocenter count, undefined bond stereocenter count, covalently-bonded unit count, and whether the compound is canonicalized.