2-Chloro-1-iodo-4-methylbenzene

• Catalog Number: ACMA00000458
• Category: Alcohols
• Molecular Weight: 252.48
• Molecular Formula: C₇H₁₂O
• Hazard Statements: H319
• RIDADR: UN 2617 3 / PGIII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C7H6ClI.

What are the synonyms of the compound?

Some synonyms of the compound include 3-Chloro-4-iodotoluene, 2-Chloro-1-iodo-4-methylbenzene, and Benzene, 2-chloro-1-iodo-4-methyl.

What is the molecular weight of the compound?

The molecular weight of the compound is 252.48 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 2-chloro-1-iodo-4-methylbenzene.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C7H6ClI/c1-5-2-3-7(9)6(8)4-5/h2-4H,1H3.

What is the InChIKey of the compound?

The InChIKey of the compound is IFXSHBHXDHPWEO-UHFFFAOYSA-N.

What is the Canonical SMILES of the compound?

The Canonical SMILES of the compound is CC1=CC(=C(C=C1)I)Cl.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 3.6.

How many hydrogen bond donor counts does the compound have?

The compound has 0 hydrogen bond donor counts.

Is the compound canonicalized?

Yes, the compound is canonicalized.