CAS
1137339-94-6 Purity
---
1137339-94-6 Purity
---
Inquiry Basket
2-Bromo-6-(trifluoromethoxy)phenyboronic acid
CAS
1451393-18-2
Catalog Number
ACM1451393182
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC name of the compound?
The IUPAC name of the compound is [2-bromo-6-(trifluoromethoxy)phenyl]boronic acid.
What is the molecular formula of the compound?
The molecular formula of the compound is C7H5BBrF3O3.
What is the molecular weight of the compound?
The molecular weight of the compound is 284.82 g/mol.
When was the compound created?
The compound was created on May 8, 2014.
When was the compound last modified?
The compound was last modified on December 2, 2023.
What is the InChI representation of the compound?
The InChI representation of the compound is InChI=1S/C7H5BBrF3O3/c9-4-2-1-3-5(6(4)8(13)14)15-7(10,11)12/h1-3,13-14H.
What is the InChIKey of the compound?
The InChIKey of the compound is XXGWXPRGFVBJKZ-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is B(C1=C(C=CC=C1Br)OC(F)(F)F)(O)O.
How many hydrogen bond donor counts does the compound have?
The compound has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 6 hydrogen bond acceptor counts.
Recommended Products
