CAS
6567-35-7 Purity
---
6567-35-7 Purity
---
Inquiry Basket
2-Bromo-5-nitrobenzoic acid
CAS
943-14-6
Catalog Number
ACM943146
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Bromo-5-nitrobenzoic acid?
The molecular formula of 2-Bromo-5-nitrobenzoic acid is C7H4BrNO4.
What is the molecular weight of 2-Bromo-5-nitrobenzoic acid?
The molecular weight of 2-Bromo-5-nitrobenzoic acid is 246.01 g/mol.
What is the IUPAC name of 2-Bromo-5-nitrobenzoic acid?
The IUPAC name of 2-Bromo-5-nitrobenzoic acid is 2-bromo-5-nitrobenzoic acid.
What is the InChI code of 2-Bromo-5-nitrobenzoic acid?
The InChI code of 2-Bromo-5-nitrobenzoic acid is InChI=1S/C7H4BrNO4/c8-6-2-1-4(9(12)13)3-5(6)7(10)11/h1-3H,(H,10,11).
What is the InChIKey of 2-Bromo-5-nitrobenzoic acid?
The InChIKey of 2-Bromo-5-nitrobenzoic acid is UVFWYVCDRKRAJH-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-5-nitrobenzoic acid?
The canonical SMILES of 2-Bromo-5-nitrobenzoic acid is C1=CC(=C(C=C1[N+](=O)[O-])C(=O)O)Br.
What is the CAS number of 2-Bromo-5-nitrobenzoic acid?
The CAS number of 2-Bromo-5-nitrobenzoic acid is 943-14-6.
What is the hydrogen bond donor count of 2-Bromo-5-nitrobenzoic acid?
The hydrogen bond donor count of 2-Bromo-5-nitrobenzoic acid is 1.
What is the hydrogen bond acceptor count of 2-Bromo-5-nitrobenzoic acid?
The hydrogen bond acceptor count of 2-Bromo-5-nitrobenzoic acid is 4.
Is 2-Bromo-5-nitrobenzoic acid canonicalized?
Yes, 2-Bromo-5-nitrobenzoic acid is canonicalized according to PubChem.
Recommended Products
![8-Bromo-4-chloro-2-(methylthio)pyrazolo[1,5-a][1,3,5]triazine](https://resource.alfa-chemistry.com/structure/54346-33-7.gif)
CAS
54346-33-7 Purity
---
54346-33-7 Purity
---
