2-Bromo-5-chloro-3-nitropyridine

• CAS: 75806-86-9
• Catalog Number: ACM75806869
• Category: Bromine Series

Custom Q&A

What is the molecular formula of 2-Bromo-5-chloro-3-nitropyridine?

The molecular formula of 2-Bromo-5-chloro-3-nitropyridine is C5H2BrClN2O2.

What is the molecular weight of 2-Bromo-5-chloro-3-nitropyridine?

The molecular weight of 2-Bromo-5-chloro-3-nitropyridine is 237.44 g/mol.

When was 2-Bromo-5-chloro-3-nitropyridine created in PubChem?

2-Bromo-5-chloro-3-nitropyridine was created in PubChem on 2005-03-26.

What are some synonyms for 2-Bromo-5-chloro-3-nitropyridine?

Some synonyms for 2-Bromo-5-chloro-3-nitropyridine include Pyridine, 2-bromo-5-chloro-3-nitro- and 2-Bromo-3-nitro-5-chloropyridine.

What is the Canonical SMILES representation of 2-Bromo-5-chloro-3-nitropyridine?

The Canonical SMILES representation of 2-Bromo-5-chloro-3-nitropyridine is C1=C(C=NC(=C1[N+](=O)[O-])Br)Cl.

What is the InChIKey for 2-Bromo-5-chloro-3-nitropyridine?

The InChIKey for 2-Bromo-5-chloro-3-nitropyridine is VFMIDVIAQMFGGP-UHFFFAOYSA-N.

What is the XLogP3-AA value for 2-Bromo-5-chloro-3-nitropyridine?

The XLogP3-AA value for 2-Bromo-5-chloro-3-nitropyridine is 2.3.

How many hydrogen bond acceptors does 2-Bromo-5-chloro-3-nitropyridine have?

2-Bromo-5-chloro-3-nitropyridine has 3 hydrogen bond acceptors.

What is the topological polar surface area of 2-Bromo-5-chloro-3-nitropyridine?

The topological polar surface area of 2-Bromo-5-chloro-3-nitropyridine is 58.7Ų.

Is the compound canonicalized in PubChem?

Yes, the compound 2-Bromo-5-chloro-3-nitropyridine is canonicalized in PubChem.