CAS
51760-04-4 Purity
97%
51760-04-4 Purity
97%
Inquiry Basket
2-Bromo-4-(trifluoromethyl)phenylacetic acid
CAS
518070-15-0
Catalog Number
ACM518070150
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Bromo-4-(trifluoromethyl)phenylacetic acid?
The molecular formula of 2-Bromo-4-(trifluoromethyl)phenylacetic acid is C9H6BrF3O2.
What is the molecular weight of 2-Bromo-4-(trifluoromethyl)phenylacetic acid?
The molecular weight of 2-Bromo-4-(trifluoromethyl)phenylacetic acid is 283.04 g/mol.
When was the compound created?
The compound was created on July 19, 2005.
When was the compound last modified?
The compound was last modified on December 2, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-[2-bromo-4-(trifluoromethyl)phenyl]acetic acid.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C9H6BrF3O2/c10-7-4-6(9(11,12)13)2-1-5(7)3-8(14)15/h1-2,4H,3H2,(H,14,15).
What is the InChIKey of the compound?
The InChIKey of the compound is VZOPDTMYQJUIIU-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1=CC(=C(C=C1C(F)(F)F)Br)CC(=O)O.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 3.
What is the hydrogen bond donor count of the compound?
The hydrogen bond donor count of the compound is 1.
Recommended Products
