2-Bromo-4-(trifluoromethoxy)phenol

• CAS: 200956-13-4
• Catalog Number: ACM200956134
• Category: Bromine Series
• Molecular Weight: 257
• Molecular Formula: C₇H₄BrF₃O₂
• Synonyms: 2-BROMO-4-(TRIFLUOROMETHOXY)PHENOL;BUTTPARK 144\07-26

Custom Q&A

What is the molecular formula of 2-Bromo-4-(trifluoromethoxy)phenol?

The molecular formula of 2-Bromo-4-(trifluoromethoxy)phenol is C7H4BrF3O2.

What is the molecular weight of 2-Bromo-4-(trifluoromethoxy)phenol?

The molecular weight of 2-Bromo-4-(trifluoromethoxy)phenol is 257.00 g/mol.

What is the IUPAC name of 2-Bromo-4-(trifluoromethoxy)phenol?

The IUPAC name of 2-Bromo-4-(trifluoromethoxy)phenol is 2-bromo-4-(trifluoromethoxy)phenol.

What is the InChI key of 2-Bromo-4-(trifluoromethoxy)phenol?

The InChI key of 2-Bromo-4-(trifluoromethoxy)phenol is YHSCBQZMCFSTGL-UHFFFAOYSA-N.

What is the canonical SMILES representation of 2-Bromo-4-(trifluoromethoxy)phenol?

The canonical SMILES representation of 2-Bromo-4-(trifluoromethoxy)phenol is C1=CC(=C(C=C1OC(F)(F)F)Br)O.

What is the CAS number of 2-Bromo-4-(trifluoromethoxy)phenol?

The CAS number of 2-Bromo-4-(trifluoromethoxy)phenol is 200956-13-4.

What is the XLogP3 value of 2-Bromo-4-(trifluoromethoxy)phenol?

The XLogP3 value of 2-Bromo-4-(trifluoromethoxy)phenol is 3.7.

How many hydrogen bond donor counts does 2-Bromo-4-(trifluoromethoxy)phenol have?

2-Bromo-4-(trifluoromethoxy)phenol has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 2-Bromo-4-(trifluoromethoxy)phenol have?

2-Bromo-4-(trifluoromethoxy)phenol has 5 hydrogen bond acceptor counts.

How many rotatable bond counts does 2-Bromo-4-(trifluoromethoxy)phenol have?

2-Bromo-4-(trifluoromethoxy)phenol has 1 rotatable bond count.