CAS
161957-61-5 Purity
---
161957-61-5 Purity
---
Inquiry Basket
2-Bromo-3,5-dimethoxy-1-fluorobenzene
CAS
206860-47-1
Catalog Number
ACM206860471
Category
Bromine Series
Molecular Weight
235.05
Molecular Formula
C8H8BrFO2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
2-BROMO-3,5-DIMETHOXY-1-FLUOROBENZENE;2-BROMO-1-FLUORO-3,5-DIMETHOXYBENZENE;2-Bromo-3,5-dimethoxy-1-fluorobenzene 98%;2-Bromo-3,5-dimethoxy-1-fluorobenzene98%
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-bromo-1-fluoro-3,5-dimethoxybenzene.
What is the molecular formula of the compound?
The molecular formula of the compound is C8H8BrFO2.
What is the molecular weight of the compound?
The molecular weight of the compound is 235.05 g/mol.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C8H8BrFO2/c1-11-5-3-6(10)8(9)7(4-5)12-2/h3-4H,1-2H3.
What is the InChIKey of the compound?
The InChIKey of the compound is DGHHLXADLQCVKV-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is COC1=CC(=C(C(=C1)F)Br)OC.
What is the CAS number of the compound?
The CAS number of the compound is 206860-47-1.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 2.7.
How many hydrogen bond donor counts are there in the compound?
There are 0 hydrogen bond donor counts in the compound.
How many rotatable bond counts are there in the compound?
There are 2 rotatable bond counts in the compound.
Recommended Products
