2-Bromo-1-(2,5-dimethoxy-phenyl)-ethanone

• CAS: 1204-21-3
• Catalog Number: ACM1204213
• Category: Bromine Series
• Molecular Weight: 259.09
• Molecular Formula: C₁₀H₁₁BrO₃

Custom Q&A

What is the molecular formula of 2-Bromo-1-(2,5-dimethoxyphenyl)-ethanone?

The molecular formula is C10H11BrO3.

What is the molecular weight of 2-Bromo-1-(2,5-dimethoxyphenyl)-ethanone?

The molecular weight is 259.10 g/mol.

What is the IUPAC name of 2-Bromo-1-(2,5-dimethoxyphenyl)-ethanone?

The IUPAC name is 2-bromo-1-(2,5-dimethoxyphenyl)ethanone.

What is the InChI code of 2-Bromo-1-(2,5-dimethoxyphenyl)-ethanone?

The InChI code is InChI=1S/C10H11BrO3/c1-13-7-3-4-10(14-2)8(5-7)9(12)6-11/h3-5H,6H2,1-2H3.

What is the InChIKey of 2-Bromo-1-(2,5-dimethoxyphenyl)-ethanone?

The InChIKey is RGQNFYVSEWDUEI-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Bromo-1-(2,5-dimethoxyphenyl)-ethanone?

The canonical SMILES is COC1=CC(=C(C=C1)OC)C(=O)CBr.

What is the CAS number of 2-Bromo-1-(2,5-dimethoxyphenyl)-ethanone?

The CAS number is 1204-21-3.

What is the XLogP3-AA value of 2-Bromo-1-(2,5-dimethoxyphenyl)-ethanone?

The XLogP3-AA value is 2.3.

How many hydrogen bond donor counts does 2-Bromo-1-(2,5-dimethoxyphenyl)-ethanone have?

It has 0 hydrogen bond donor counts.

How many rotatable bond counts does 2-Bromo-1-(2,5-dimethoxyphenyl)-ethanone have?

It has 4 rotatable bond counts.