2-Amino-6-methyl-4,5,6,7-tetrahydro-benzo[b]thiophene-3-carboxylic acid amide

• Catalog Number: ACMA00000840
• Category: Amines
• Molecular Weight: 210.30
• Molecular Formula: C₁₀H₁₄ClNO₂
• Hazard Statements: H318
• RIDADR: UN 2811 6.1 / PGIII
• Symbol: GHS05

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C10H14N2OS.

What is the molecular weight of the compound?

The molecular weight of the compound is 210.30 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C10H14N2OS/c1-5-2-3-6-7(4-5)14-10(12)8(6)9(11)13/h5H,2-4,12H2,1H3,(H2,11,13).

What is the InChIKey of the compound?

The InChIKey of the compound is LSRQCZCDBRHPHQ-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CC1CCC2=C(C1)SC(=C2C(=O)N)N.

What is the CAS number of the compound?

The CAS number of the compound is 95211-68-0.

How many hydrogen bond donor counts does the compound have?

The compound has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does the compound have?

The compound has 3 hydrogen bond acceptor counts.

What is the topological polar surface area of the compound?

The topological polar surface area of the compound is 97.4 Ų.