2-Amino-5-methoxy-benzeneacetic acid

• CAS: 38367-42-9
• Catalog Number: ACM38367429
• Category: Other Products
• Molecular Weight: 0
• Molecular Formula: C₉H₁₁NO₃
• Synonyms: 2-AMINO-5-METHOXY-BENZENEACETIC ACID;Benzeneacetic acid, 2-aMino-5-Methoxy-;2-(2-AMino-5-Methoxyphenyl)acetic acid;(2-amino-5-methoxy-phenyl)-acetic acid

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C9H11NO3.

What are the synonyms of the compound?

The synonyms of the compound are 2-(2-Amino-5-methoxyphenyl)acetic acid, 38367-42-9, 2-amino-5-methoxy-benzeneacetic acid, SCHEMBL16372581, DTXSID301295265.

What is the molecular weight of the compound?

The molecular weight of the compound is 181.19 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 2-(2-amino-5-methoxyphenyl)acetic acid.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C9H11NO3/c1-13-7-2-3-8(10)6(4-7)5-9(11)12/h2-4H,5,10H2,1H3,(H,11,12).

What is the InChIKey of the compound?

The InChIKey of the compound is PGQFWSIBEQNJNC-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is COC1=CC(=C(C=C1)N)CC(=O)O.

What is the CAS number of the compound?

The CAS number of the compound is 38367-42-9.

What is the XLogP3 value of the compound?

The XLogP3 value of the compound is 0.3.

What is the hydrogen bond donor count of the compound?

The hydrogen bond donor count of the compound is 2.