2-Amino-3-bromo-5-nitro-6-picoline

• CAS: 150935-62-9
• Catalog Number: ACM150935629
• Category: Bromine Series
• Molecular Formula: C₆H₆BrN₃O₂
• Synonyms: 2-Amino-3-bromo-6-methyl-5-nitropyridine

Custom Q&A

What is the molecular formula of the compound with PubChem CID 29919319?

The molecular formula is C6H6BrN3O2.

When was the compound created on PubChem?

The compound was created on 2009-05-28.

What is the IUPAC name of the compound?

The IUPAC name is 3-bromo-6-methyl-5-nitropyridin-2-amine.

What is the Canonical SMILES of the compound?

The Canonical SMILES is CC1=NC(=C(C=C1[N+](=O)[O-])Br)N.

What is the molecular weight of the compound?

The molecular weight is 232.03 g/mol.

What is the InChIKey of the compound?

The InChIKey is QEACSSLDLWHNGC-UHFFFAOYSA-N.

How many hydrogen bond donor counts does the compound have?

The compound has 1 hydrogen bond donor count.

What is the heavy atom count of the compound?

The heavy atom count is 12.

Is the compound canonicalized?

Yes, the compound is canonicalized.

What is the topological polar surface area of the compound?

The topological polar surface area is 84.7Ų.