CAS
--- Purity
---
--- Purity
---
Inquiry Basket
2-Amino-2-methyl-4-phenylbutanoic acid hydrochloride
Catalog Number
ACMA00000935
Category
Amines
Molecular Weight
229.70
Molecular Formula
C11H15NS
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H302
RIDADR
NONH for all modes of transport
Symbol
GHS07
What is the molecular formula of 2-Amino-2-methyl-4-phenylbutanoic acid hydrochloride?
The molecular formula of 2-Amino-2-methyl-4-phenylbutanoic acid hydrochloride is C11H16ClNO2.
What is the molecular weight of 2-Amino-2-methyl-4-phenylbutanoic acid hydrochloride?
The molecular weight of 2-Amino-2-methyl-4-phenylbutanoic acid hydrochloride is 229.70 g/mol.
What is the IUPAC name of 2-Amino-2-methyl-4-phenylbutanoic acid hydrochloride?
The IUPAC name of 2-Amino-2-methyl-4-phenylbutanoic acid hydrochloride is 2-amino-2-methyl-4-phenylbutanoic acid;hydrochloride.
What is the InChI key of 2-Amino-2-methyl-4-phenylbutanoic acid hydrochloride?
The InChI key of 2-Amino-2-methyl-4-phenylbutanoic acid hydrochloride is FZZUHWSNACMZOB-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Amino-2-methyl-4-phenylbutanoic acid hydrochloride?
The canonical SMILES of 2-Amino-2-methyl-4-phenylbutanoic acid hydrochloride is CC(CCC1=CC=CC=C1)(C(=O)O)N.Cl.
What is the hydrogen bond donor count of 2-Amino-2-methyl-4-phenylbutanoic acid hydrochloride?
The hydrogen bond donor count of 2-Amino-2-methyl-4-phenylbutanoic acid hydrochloride is 3.
What is the hydrogen bond acceptor count of 2-Amino-2-methyl-4-phenylbutanoic acid hydrochloride?
The hydrogen bond acceptor count of 2-Amino-2-methyl-4-phenylbutanoic acid hydrochloride is 3.
How many rotatable bonds does 2-Amino-2-methyl-4-phenylbutanoic acid hydrochloride have?
2-Amino-2-methyl-4-phenylbutanoic acid hydrochloride has 4 rotatable bonds.
What is the exact mass of 2-Amino-2-methyl-4-phenylbutanoic acid hydrochloride?
The exact mass of 2-Amino-2-methyl-4-phenylbutanoic acid hydrochloride is 229.0869564 g/mol.
How many covalently-bonded units does 2-Amino-2-methyl-4-phenylbutanoic acid hydrochloride have?
2-Amino-2-methyl-4-phenylbutanoic acid hydrochloride has 2 covalently-bonded units.
Recommended Products
