CAS
--- Purity
---
--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula is C10H16N2.
The molecular weight is 164.25 g/mol.
Some synonyms include N1,N1-dimethyl-1-phenylethane-1,2-diamine and N,N-dimethyl-1-phenylethane-1,2-diamine.
The InChI is InChI=1S/C10H16N2/c1-12(2)10(8-11)9-6-4-3-5-7-9/h3-7,10H,8,11H2,1-2H3.
There are 2 hydrogen bond acceptor counts.
Yes, the compound is canonicalized.
The topological polar surface area is 29.3Ų.
There are 3 rotatable bonds.
The XLogP3-AA value is 0.9.
The CAS number is 6342-21-8.