2-Amino-1-naphthol hydrochloride

• Catalog Number: ACMA00000903
• Category: Amines
• Molecular Weight: 195.65
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 2-Amino-1-naphthol hydrochloride?

The molecular formula is C10H10ClNO.

What is the molecular weight of 2-Amino-1-naphthol hydrochloride?

The molecular weight is 195.64 g/mol.

What is the IUPAC name of 2-Amino-1-naphthol hydrochloride?

The IUPAC name is 2-aminonaphthalen-1-ol;hydrochloride.

What is the InChI of 2-Amino-1-naphthol hydrochloride?

The InChI is InChI=1S/C10H9NO.ClH/c11-9-6-5-7-3-1-2-4-8(7)10(9)12;/h1-6,12H,11H2;1H.

What is the InChIKey of 2-Amino-1-naphthol hydrochloride?

The InChIKey is PEJOQASNBCUDMB-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Amino-1-naphthol hydrochloride?

The canonical SMILES is C1=CC=C2C(=C1)C=CC(=C2O)N.Cl.

What is the CAS number of 2-Amino-1-naphthol hydrochloride?

The CAS number is 41772-23-0.

What is the European Community (EC) number of 2-Amino-1-naphthol hydrochloride?

The EC number is 255-548-5.

What is the UNII of 2-Amino-1-naphthol hydrochloride?

The UNII is 0F1K0BRO5V.

What is the hydrogen bond donor count of 2-Amino-1-naphthol hydrochloride?

The hydrogen bond donor count is 3.