2-Allyloxy-1,3,5-tribromobenzene

• CAS: 3278-89-5
• Catalog Number: ACM3278895
• Category: Polymer/Macromolecule
• Molecular Weight: 370.86
• Molecular Formula: C₉H₇Br₃O
• Synonyms: 1,3,5-tribromo-2-(2-propenyloxy)-benzen;Benzene,1,3,5-tribromo-2-(2-propenyloxy);TRIBROMOPHENYL ALLYL ETHER;ALLYL 2,4,6-TRIBROMOPHENYL ETHER;ALLYL TRIBROMOPHENYL ETHER;2-allyloxy-1,3,5-tribromobenzene;1,3,5-TRIBROMO-2-(2-PROPENYLOXY)-BENZENE;2,4,6-Tribrom

Custom Q&A

What is the molecular formula of 2-Allyloxy-1,3,5-tribromobenzene?

The molecular formula of 2-Allyloxy-1,3,5-tribromobenzene is C9H7Br3O.

What is the molecular weight of 2-Allyloxy-1,3,5-tribromobenzene?

The molecular weight of 2-Allyloxy-1,3,5-tribromobenzene is 370.86 g/mol.

What is the IUPAC Name of 2-Allyloxy-1,3,5-tribromobenzene?

The IUPAC Name of 2-Allyloxy-1,3,5-tribromobenzene is 1,3,5-tribromo-2-prop-2-enoxybenzene.

What is the InChI of 2-Allyloxy-1,3,5-tribromobenzene?

The InChI of 2-Allyloxy-1,3,5-tribromobenzene is InChI=1S/C9H7Br3O/c1-2-3-13-9-7(11)4-6(10)5-8(9)12/h2,4-5H,1,3H2.

What is the InChIKey of 2-Allyloxy-1,3,5-tribromobenzene?

The InChIKey of 2-Allyloxy-1,3,5-tribromobenzene is RZLLIOPGUFOWOD-UHFFFAOYSA-N.

What is the Canonical SMILES of 2-Allyloxy-1,3,5-tribromobenzene?

The Canonical SMILES of 2-Allyloxy-1,3,5-tribromobenzene is C=CCOC1=C(C=C(C=C1Br)Br)Br.

What is the CAS number of 2-Allyloxy-1,3,5-tribromobenzene?

The CAS number of 2-Allyloxy-1,3,5-tribromobenzene is 3278-89-5.

How many hydrogen bond donor counts does 2-Allyloxy-1,3,5-tribromobenzene have?

2-Allyloxy-1,3,5-tribromobenzene has 0 hydrogen bond donor counts.

What is the topological polar surface area of 2-Allyloxy-1,3,5-tribromobenzene?

The topological polar surface area of 2-Allyloxy-1,3,5-tribromobenzene is 9.2Ų.

How many rotatable bond counts does 2-Allyloxy-1,3,5-tribromobenzene have?

2-Allyloxy-1,3,5-tribromobenzene has 3 rotatable bond counts.