2-Adamantyl-4-bromophenol

• CAS: 104224-68-2
• Catalog Number: ACM104224682
• Category: Bromine Series
• Molecular Weight: 307.23
• Molecular Formula: C₁₆H₁₉BrO

Custom Q&A

What is the molecular formula of 2-Adamantyl-4-bromophenol?

The molecular formula of 2-Adamantyl-4-bromophenol is C16H19BrO.

What is the molecular weight of 2-Adamantyl-4-bromophenol?

The molecular weight of 2-Adamantyl-4-bromophenol is 307.22 g/mol.

What is the IUPAC name of 2-Adamantyl-4-bromophenol?

The IUPAC name of 2-Adamantyl-4-bromophenol is 2-(1-adamantyl)-4-bromophenol.

What is the InChI of 2-Adamantyl-4-bromophenol?

The InChI of 2-Adamantyl-4-bromophenol is InChI=1S/C16H19BrO/c17-13-1-2-15(18)14(6-13)16-7-10-3-11(8-16)5-12(4-10)9-16/h1-2,6,10-12,18H,3-5,7-9H2.

What is the InChIKey of 2-Adamantyl-4-bromophenol?

The InChIKey of 2-Adamantyl-4-bromophenol is NYJXKHIVLGWPCF-UHFFFAOYSA-N.

What is the Canonical SMILES of 2-Adamantyl-4-bromophenol?

The Canonical SMILES of 2-Adamantyl-4-bromophenol is C1C2CC3CC1CC(C2)(C3)C4=C(C=CC(=C4)Br)O.

How many hydrogen bond donor counts does 2-Adamantyl-4-bromophenol have?

2-Adamantyl-4-bromophenol has 1 hydrogen bond donor count.

What is the XLogP3-AA value of 2-Adamantyl-4-bromophenol?

The XLogP3-AA value of 2-Adamantyl-4-bromophenol is 5.7.

What is the topological polar surface area of 2-Adamantyl-4-bromophenol?

The topological polar surface area of 2-Adamantyl-4-bromophenol is 20.2Ų.

Is 2-Adamantyl-4-bromophenol a canonicalized compound?

Yes, 2-Adamantyl-4-bromophenol is a canonicalized compound.