CAS
--- Purity
---
--- Purity
---
Inquiry Basket
2-Acetamido-5-fluorobenzoic acid
Catalog Number
ACMA00001713
Category
Aryl Fluorinated Building Blocks
Molecular Weight
197.16
Molecular Formula
C9H8ClFO2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H302-H315-H319-H335
RIDADR
NONH for all modes of transport
Symbol
GHS07
What is the molecular formula of 2-Acetamido-5-fluorobenzoic acid?
The molecular formula of 2-Acetamido-5-fluorobenzoic acid is C9H8FNO3.
What is the molecular weight of 2-Acetamido-5-fluorobenzoic acid?
The molecular weight of 2-Acetamido-5-fluorobenzoic acid is 197.16 g/mol.
What is the InChI of 2-Acetamido-5-fluorobenzoic acid?
The InChI of 2-Acetamido-5-fluorobenzoic acid is InChI=1S/C9H8FNO3/c1-5(12)11-8-3-2-6(10)4-7(8)9(13)14/h2-4H,1H3,(H,11,12)(H,13,14).
What is the InChIKey of 2-Acetamido-5-fluorobenzoic acid?
The InChIKey of 2-Acetamido-5-fluorobenzoic acid is QNHDURZULPJHIT-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-Acetamido-5-fluorobenzoic acid?
The Canonical SMILES of 2-Acetamido-5-fluorobenzoic acid is CC(=O)NC1=C(C=C(C=C1)F)C(=O)O.
What is the CAS number of 2-Acetamido-5-fluorobenzoic acid?
The CAS number of 2-Acetamido-5-fluorobenzoic acid is 49579-56-8.
How many hydrogen bond donor counts does 2-Acetamido-5-fluorobenzoic acid have?
2-Acetamido-5-fluorobenzoic acid has 2 hydrogen bond donor counts.
What is the topological polar surface area of 2-Acetamido-5-fluorobenzoic acid?
The topological polar surface area of 2-Acetamido-5-fluorobenzoic acid is 66.4 Ų.
How many rotatable bond counts does 2-Acetamido-5-fluorobenzoic acid have?
2-Acetamido-5-fluorobenzoic acid has 2 rotatable bond counts.
Is 2-Acetamido-5-fluorobenzoic acid a canonicalized compound?
Yes, 2-Acetamido-5-fluorobenzoic acid is a canonicalized compound.
Recommended Products
