41720-98-3 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 2,6-Dichloro-3-(chloromethyl)pyridine is C6H4Cl3N.
The molecular weight of 2,6-Dichloro-3-(chloromethyl)pyridine is 196.5 g/mol.
The IUPAC name of 2,6-Dichloro-3-(chloromethyl)pyridine is 2,6-dichloro-3-(chloromethyl)pyridine.
The InChI of 2,6-Dichloro-3-(chloromethyl)pyridine is InChI=1S/C6H4Cl3N/c7-3-4-1-2-5(8)10-6(4)9/h1-2H,3H2.
The InChIKey of 2,6-Dichloro-3-(chloromethyl)pyridine is CMPPTKONDXHDBF-UHFFFAOYSA-N.
The canonical SMILES of 2,6-Dichloro-3-(chloromethyl)pyridine is C1=CC(=NC(=C1CCl)Cl)Cl.
The CAS number of 2,6-Dichloro-3-(chloromethyl)pyridine is 41789-37-1.
The XLogP3-AA value of 2,6-Dichloro-3-(chloromethyl)pyridine is 3.2.
Yes, 2,6-Dichloro-3-(chloromethyl)pyridine is considered a canonicalized compound.