515140-26-8 Purity
98%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 2,5-Dichloropyridine-3-boronic acid is C5H4BCl2NO2.
The molecular weight of 2,5-Dichloropyridine-3-boronic acid is 191.81 g/mol.
The IUPAC name of 2,5-Dichloropyridine-3-boronic acid is (2,5-dichloropyridin-3-yl)boronic acid.
The InChI of 2,5-Dichloropyridine-3-boronic acid is InChI=1S/C5H4BCl2NO2/c7-3-1-4(6(10)11)5(8)9-2-3/h1-2,10-11H.
The InChIKey of 2,5-Dichloropyridine-3-boronic acid is IISUHTJFLBUMKT-UHFFFAOYSA-N.
The canonical SMILES of 2,5-Dichloropyridine-3-boronic acid is B(C1=CC(=CN=C1Cl)Cl)(O)O.
The CAS number of 2,5-Dichloropyridine-3-boronic acid is 536693-97-7.
The ChEMBL ID of 2,5-Dichloropyridine-3-boronic acid is CHEMBL3236925.
The hydrogen bond donor count of 2,5-Dichloropyridine-3-boronic acid is 2.
Yes, 2,5-Dichloropyridine-3-boronic acid is the canonical form.