2,5-Dibromo-3-methylpyridine

• CAS: 3430-18-0
• Catalog Number: ACM3430180
• Category: Pyridines
• Molecular Weight: 250.92
• Molecular Formula: C6H5Br2N
• Synonyms: 2,5-Dibromo-3-picoline
• Melting Point: 43-47 °C
• Flash Point: >110 °C
• Appearance: Pale yellow crystalline

Custom Q&A

What is the IUPAC name of 2,5-Dibromo-3-methylpyridine?

The IUPAC name of 2,5-Dibromo-3-methylpyridine is 2,5-dibromo-3-methylpyridine.

What is the molecular formula of 2,5-Dibromo-3-methylpyridine?

The molecular formula of 2,5-Dibromo-3-methylpyridine is C6H5Br2N.

What is the molecular weight of 2,5-Dibromo-3-methylpyridine?

The molecular weight of 2,5-Dibromo-3-methylpyridine is 250.92 g/mol.

What is the InChI of 2,5-Dibromo-3-methylpyridine?

The InChI of 2,5-Dibromo-3-methylpyridine is InChI=1S/C6H5Br2N/c1-4-2-5(7)3-9-6(4)8/h2-3H,1H3.

What is the InChIKey of 2,5-Dibromo-3-methylpyridine?

The InChIKey of 2,5-Dibromo-3-methylpyridine is LIMXEVCFAUTBCK-UHFFFAOYSA-N.

What is the canonical SMILES of 2,5-Dibromo-3-methylpyridine?

The canonical SMILES of 2,5-Dibromo-3-methylpyridine is CC1=CC(=CN=C1Br)Br.

What is the CAS number of 2,5-Dibromo-3-methylpyridine?

The CAS number of 2,5-Dibromo-3-methylpyridine is 3430-18-0.

What is the XLogP3-AA value of 2,5-Dibromo-3-methylpyridine?

The XLogP3-AA value of 2,5-Dibromo-3-methylpyridine is 2.9.

How many hydrogen bond donor counts are there in 2,5-Dibromo-3-methylpyridine?

There are 0 hydrogen bond donor counts in 2,5-Dibromo-3-methylpyridine.

How many hydrogen bond acceptor counts are there in 2,5-Dibromo-3-methylpyridine?

There is 1 hydrogen bond acceptor count in 2,5-Dibromo-3-methylpyridine.