2,5-Diaminoadipic acid 2hcl

• CAS: 52408-04-5
• Catalog Number: ACM52408045
• Category: Other Products
• Molecular Weight: 249.09236
• Molecular Formula: C₆H₁₄Cl₂N₂O₄
• Synonyms: 2,5-Diaminoadipic acid 2HCl;2,4-DIAMINO-HEXANEDIOIC ACID DIHYDROCHLORIDE;2,5-Diaminoadipic acid dihydrochloride;2,5-Diamino-hexanedioic acid dihydrochloride;REF DUPL: 2,5-Diaminoadipic acid 2HCl

Custom Q&A

What is the molecular formula of 2,5-Diaminoadipic acid 2hcl?

The molecular formula of 2,5-Diaminoadipic acid 2hcl is C6H14Cl2N2O4.

What is the molecular weight of 2,5-Diaminoadipic acid 2hcl?

The molecular weight of 2,5-Diaminoadipic acid 2hcl is 249.09 g/mol.

What is the IUPAC name of 2,5-Diaminoadipic acid 2hcl?

The IUPAC name of 2,5-Diaminoadipic acid 2hcl is 2,5-diaminohexanedioic acid;dihydrochloride.

What is the InChI of 2,5-Diaminoadipic acid 2hcl?

The InChI of 2,5-Diaminoadipic acid 2hcl is InChI=1S/C6H12N2O4.2ClH/c7-3(5(9)10)1-2-4(8)6(11)12;;/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12);2*1H.

What is the InChIKey of 2,5-Diaminoadipic acid 2hcl?

The InChIKey of 2,5-Diaminoadipic acid 2hcl is OLQCFLWGFNLVME-UHFFFAOYSA-N.

What is the canonical SMILES of 2,5-Diaminoadipic acid 2hcl?

The canonical SMILES of 2,5-Diaminoadipic acid 2hcl is C(CC(C(=O)O)N)C(C(=O)O)N.Cl.Cl.

How many hydrogen bond donor counts are there in 2,5-Diaminoadipic acid 2hcl?

There are 6 hydrogen bond donor counts in 2,5-Diaminoadipic acid 2hcl.

How many hydrogen bond acceptor counts are there in 2,5-Diaminoadipic acid 2hcl?

There are 6 hydrogen bond acceptor counts in 2,5-Diaminoadipic acid 2hcl.

How many rotatable bond counts are there in 2,5-Diaminoadipic acid 2hcl?

There are 5 rotatable bond counts in 2,5-Diaminoadipic acid 2hcl.

What is the topological polar surface area of 2,5-Diaminoadipic acid 2hcl?

The topological polar surface area of 2,5-Diaminoadipic acid 2hcl is 127 Ų.