2-(4-Methoxyphenyl)acetohydrazide

• Catalog Number: ACMA00002865
• Category: Ethers
• Molecular Weight: 180.20
• Molecular Formula: C₉H₁₁NO₂
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 2-(4-Methoxyphenyl)acetohydrazide?

The molecular formula of 2-(4-Methoxyphenyl)acetohydrazide is C9H12N2O2.

What is the molecular weight of 2-(4-Methoxyphenyl)acetohydrazide?

The molecular weight of 2-(4-Methoxyphenyl)acetohydrazide is 180.20 g/mol.

What is the IUPAC name of 2-(4-Methoxyphenyl)acetohydrazide?

The IUPAC name of 2-(4-Methoxyphenyl)acetohydrazide is 2-(4-methoxyphenyl)acetohydrazide.

What is the InChI of 2-(4-Methoxyphenyl)acetohydrazide?

The InChI of 2-(4-Methoxyphenyl)acetohydrazide is InChI=1S/C9H12N2O2/c1-13-8-4-2-7(3-5-8)6-9(12)11-10/h2-5H,6,10H2,1H3,(H,11,12).

How many hydrogen bond donor counts are there in 2-(4-Methoxyphenyl)acetohydrazide?

There are 2 hydrogen bond donor counts in 2-(4-Methoxyphenyl)acetohydrazide.

What is the topological polar surface area of 2-(4-Methoxyphenyl)acetohydrazide?

The topological polar surface area of 2-(4-Methoxyphenyl)acetohydrazide is 64.4Ų.

Is the compound canonicalized?

Yes, the compound is canonicalized.

What other identifiers are associated with 2-(4-Methoxyphenyl)acetohydrazide?

The other identifiers associated with 2-(4-Methoxyphenyl)acetohydrazide include CAS number 57676-49-0, EPA DSSTox ID DTXSID60342079, and EC number 869-101-2.

What is the XLogP3 value of 2-(4-Methoxyphenyl)acetohydrazide?

The XLogP3 value of 2-(4-Methoxyphenyl)acetohydrazide is 0.4.

What is the exact mass of 2-(4-Methoxyphenyl)acetohydrazide?

The exact mass of 2-(4-Methoxyphenyl)acetohydrazide is 180.089877630 g/mol.