2-(4-Fluorophenoxy)ethanesulfonyl chloride

• Catalog Number: ACMA00001888
• Category: Aryl Fluorinated Building Blocks
• Molecular Weight: 238.66
• Molecular Formula: C₇H₅ClFNO₄S
• Hazard Statements: H301
• RIDADR: NONH for all modes of transport
• Symbol: GHS06

Custom Q&A

What is the molecular weight of 2-(4-Fluorophenoxy)ethanesulfonyl chloride?

The molecular weight of 2-(4-Fluorophenoxy)ethanesulfonyl chloride is 238.66 g/mol.

What is the IUPAC name of 2-(4-Fluorophenoxy)ethanesulfonyl chloride?

The IUPAC name of 2-(4-Fluorophenoxy)ethanesulfonyl chloride is 2-(4-fluorophenoxy)ethanesulfonyl chloride.

What is the InChI key of 2-(4-Fluorophenoxy)ethanesulfonyl chloride?

The InChI key of 2-(4-Fluorophenoxy)ethanesulfonyl chloride is VGZMGRHCUYOATF-UHFFFAOYSA-N.

What is the canonical SMILES of 2-(4-Fluorophenoxy)ethanesulfonyl chloride?

The canonical SMILES of 2-(4-Fluorophenoxy)ethanesulfonyl chloride is C1=CC(=CC=C1OCCS(=O)(=O)Cl)F.

What is the molecular formula of 2-(4-Fluorophenoxy)ethanesulfonyl chloride?

The molecular formula of 2-(4-Fluorophenoxy)ethanesulfonyl chloride is C8H8ClFO3S.

What is the CAS number of 2-(4-Fluorophenoxy)ethanesulfonyl chloride?

The CAS number of 2-(4-Fluorophenoxy)ethanesulfonyl chloride is 1018548-27-0.

What is the XLogP3-AA value of 2-(4-Fluorophenoxy)ethanesulfonyl chloride?

The XLogP3-AA value of 2-(4-Fluorophenoxy)ethanesulfonyl chloride is 2.2.

How many hydrogen bond donor counts does 2-(4-Fluorophenoxy)ethanesulfonyl chloride have?

2-(4-Fluorophenoxy)ethanesulfonyl chloride has 0 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 2-(4-Fluorophenoxy)ethanesulfonyl chloride have?

2-(4-Fluorophenoxy)ethanesulfonyl chloride has 4 hydrogen bond acceptor counts.

How many rotatable bond counts does 2-(4-Fluorophenoxy)ethanesulfonyl chloride have?

2-(4-Fluorophenoxy)ethanesulfonyl chloride has 4 rotatable bond counts.