2-[4-(Dimethylamino)phenyl]ethanol

• CAS: 50438-75-0
• Catalog Number: ACM50438750
• Category: Aryl
• Molecular Weight: 165.23
• Hazard Statements: H302-H315-H319-H335-H400
• RIDADR: UN 3265 8 / PGII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C10H15NO.

What is the molecular weight of the compound?

The molecular weight of the compound is 165.23 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 2-[4-(dimethylamino)phenyl]ethanol.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C10H15NO/c1-11(2)10-5-3-9(4-6-10)7-8-12/h3-6,12H,7-8H2,1-2H3.

What is the InChIKey of the compound?

The InChIKey of the compound is CDTPAAZQBPSVGS-UHFFFAOYSA-N.

What is the Canonical SMILES of the compound?

The Canonical SMILES of the compound is CN(C)C1=CC=C(C=C1)CCO.

What is the CAS number of the compound?

The CAS number of the compound is 50438-75-0.

How many hydrogen bond donor counts does the compound have?

The compound has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does the compound have?

The compound has 2 hydrogen bond acceptor counts.

What is the topological polar surface area of the compound?

The topological polar surface area of the compound is 23.5 Ų.