2,4-Dimethoxythieno[3,2-d]pyrimidine

• CAS: 16229-02-0
• Catalog Number: ACM16229020
• Category: Thiophenes
• Molecular Weight: 196.23
• Molecular Formula: C8H8N2O2S
• Synonyms: Thieno[3,2-d]pyrimidine, 2,4-dimethoxy-

Custom Q&A

What is the molecular formula of 2,4-Dimethoxythieno[3,2-d]pyrimidine?

The molecular formula is C8H8N2O2S.

What is the molecular weight of 2,4-Dimethoxythieno[3,2-d]pyrimidine?

The molecular weight is 196.23 g/mol.

What is the IUPAC name of 2,4-Dimethoxythieno[3,2-d]pyrimidine?

The IUPAC name is 2,4-dimethoxythieno[3,2-d]pyrimidine.

What is the InChI code of 2,4-Dimethoxythieno[3,2-d]pyrimidine?

The InChI code is InChI=1S/C8H8N2O2S/c1-11-7-6-5(3-4-13-6)9-8(10-7)12-2/h3-4H,1-2H3.

What is the InChIKey of 2,4-Dimethoxythieno[3,2-d]pyrimidine?

The InChIKey is BLQHVGIQCWHGGO-UHFFFAOYSA-N.

What is the canonical SMILES of 2,4-Dimethoxythieno[3,2-d]pyrimidine?

The canonical SMILES is COC1=NC(=NC2=C1SC=C2)OC.

What is the XLogP3-AA value of 2,4-Dimethoxythieno[3,2-d]pyrimidine?

The XLogP3-AA value is 1.9.

How many hydrogen bond donor counts does 2,4-Dimethoxythieno[3,2-d]pyrimidine have?

It has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 2,4-Dimethoxythieno[3,2-d]pyrimidine have?

It has 5 hydrogen bond acceptor counts.

How many rotatable bond counts does 2,4-Dimethoxythieno[3,2-d]pyrimidine have?

It has 2 rotatable bond counts.