CAS
374790-97-3 Purity
---
374790-97-3 Purity
---
Inquiry Basket
2,4-Difluoro-3-methoxyphenylboronic acid
CAS
406482-18-6
Catalog Number
ACM406482186
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2,4-Difluoro-3-methoxyphenylboronic acid?
The molecular formula of 2,4-Difluoro-3-methoxyphenylboronic acid is C7H7BF2O3.
What are some synonyms for 2,4-Difluoro-3-methoxyphenylboronic acid?
Some synonyms for 2,4-Difluoro-3-methoxyphenylboronic acid include 406482-18-6, (2,4-Difluoro-3-methoxyphenyl)boronic acid, and MFCD19981523.
What is the molecular weight of 2,4-Difluoro-3-methoxyphenylboronic acid?
The molecular weight of 2,4-Difluoro-3-methoxyphenylboronic acid is 187.94 g/mol.
When was 2,4-Difluoro-3-methoxyphenylboronic acid created?
2,4-Difluoro-3-methoxyphenylboronic acid was created on January 11, 2012.
When was 2,4-Difluoro-3-methoxyphenylboronic acid last modified?
2,4-Difluoro-3-methoxyphenylboronic acid was last modified on December 2, 2023.
What is the IUPAC name of 2,4-Difluoro-3-methoxyphenylboronic acid?
The IUPAC name of 2,4-Difluoro-3-methoxyphenylboronic acid is (2,4-difluoro-3-methoxyphenyl)boronic acid.
What is the InChI of 2,4-Difluoro-3-methoxyphenylboronic acid?
The InChI of 2,4-Difluoro-3-methoxyphenylboronic acid is InChI=1S/C7H7BF2O3/c1-13-7-5(9)3-2-4(6(7)10)8(11)12/h2-3,11-12H,1H3.
What is the InChIKey of 2,4-Difluoro-3-methoxyphenylboronic acid?
The InChIKey of 2,4-Difluoro-3-methoxyphenylboronic acid is NRIQRAMCXSJILE-UHFFFAOYSA-N.
What is the canonical SMILES of 2,4-Difluoro-3-methoxyphenylboronic acid?
The canonical SMILES of 2,4-Difluoro-3-methoxyphenylboronic acid is B(C1=C(C(=C(C=C1)F)OC)F)(O)O.
What is the CAS number of 2,4-Difluoro-3-methoxyphenylboronic acid?
The CAS number of 2,4-Difluoro-3-methoxyphenylboronic acid is 406482-18-6.
Recommended Products
