2,4-Dichloro-6-methylaniline

• CAS: 30273-00-8
• Catalog Number: ACM30273008
• Category: Amines
• Molecular Weight: 176.04
• Molecular Formula: C₇H₇Br₂N
• Hazard Statements: H319
• RIDADR: UN 2735PSN1 8 / PGIII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 2,4-Dichloro-6-methylaniline?

The molecular formula of 2,4-Dichloro-6-methylaniline is C7H7Cl2N.

What is the molecular weight of 2,4-Dichloro-6-methylaniline?

The molecular weight of 2,4-Dichloro-6-methylaniline is 176.04 g/mol.

What is the IUPAC name of 2,4-Dichloro-6-methylaniline?

The IUPAC name of 2,4-Dichloro-6-methylaniline is 2,4-dichloro-6-methylaniline.

What is the InChI of 2,4-Dichloro-6-methylaniline?

The InChI of 2,4-Dichloro-6-methylaniline is InChI=1S/C7H7Cl2N/c1-4-2-5(8)3-6(9)7(4)10/h2-3H,10H2,1H3.

What is the InChIKey of 2,4-Dichloro-6-methylaniline?

The InChIKey of 2,4-Dichloro-6-methylaniline is UAISVUGQLKXPFF-UHFFFAOYSA-N.

What is the canonical SMILES representation of 2,4-Dichloro-6-methylaniline?

The canonical SMILES representation of 2,4-Dichloro-6-methylaniline is CC1=CC(=CC(=C1N)Cl)Cl.

What is the CAS number of 2,4-Dichloro-6-methylaniline?

The CAS number of 2,4-Dichloro-6-methylaniline is 30273-00-8.

What is the European Community (EC) number of 2,4-Dichloro-6-methylaniline?

The European Community (EC) number of 2,4-Dichloro-6-methylaniline is 625-812-8.

What is the Monoisotopic Mass of 2,4-Dichloro-6-methylaniline?

The Monoisotopic Mass of 2,4-Dichloro-6-methylaniline is 174.9955546 g/mol.

Is 2,4-Dichloro-6-methylaniline a canonicalized compound?

Yes, 2,4-Dichloro-6-methylaniline is a canonicalized compound.