2,4-Dichloro-5-nitropyrimidine

• CAS: 49845-33-2
• Catalog Number: ACM49845332
• Category: Pyrimidines
• Molecular Weight: 193.98
• Molecular Formula: C4HCl2N3O2
• Boiling Point: 0.9 °C/0.5 mmHg
• Melting Point: 28-32 °C

Custom Q&A

What is the molecular weight of 2,4-Dichloro-5-nitropyrimidine?

The molecular weight of 2,4-Dichloro-5-nitropyrimidine is 193.97 g/mol.

What is the IUPAC name of 2,4-Dichloro-5-nitropyrimidine?

The IUPAC name of 2,4-Dichloro-5-nitropyrimidine is 2,4-dichloro-5-nitropyrimidine.

What is the molecular formula of 2,4-Dichloro-5-nitropyrimidine?

The molecular formula of 2,4-Dichloro-5-nitropyrimidine is C4HCl2N3O2.

How many hydrogen bond acceptors does 2,4-Dichloro-5-nitropyrimidine have?

2,4-Dichloro-5-nitropyrimidine has 4 hydrogen bond acceptors.

What is the Canonical SMILES representation of 2,4-Dichloro-5-nitropyrimidine?

The Canonical SMILES representation of 2,4-Dichloro-5-nitropyrimidine is C1=C(C(=NC(=N1)Cl)Cl)[N+](=O)[O-].

What is the InChIKey of 2,4-Dichloro-5-nitropyrimidine?

The InChIKey of 2,4-Dichloro-5-nitropyrimidine is INUSQTPGSHFGHM-UHFFFAOYSA-N.

What is the XLogP3-AA value of 2,4-Dichloro-5-nitropyrimidine?

The XLogP3-AA value of 2,4-Dichloro-5-nitropyrimidine is 2.

How many heavy atoms does 2,4-Dichloro-5-nitropyrimidine contain?

2,4-Dichloro-5-nitropyrimidine contains 11 heavy atoms.

Is 2,4-Dichloro-5-nitropyrimidine a covalently-bonded unit?

Yes, 2,4-Dichloro-5-nitropyrimidine is a covalently-bonded unit.

When was 2,4-Dichloro-5-nitropyrimidine created and last modified?

2,4-Dichloro-5-nitropyrimidine was created on 2005-03-27 and last modified on 2023-12-30.