CAS
54879-20-8 Purity
96%
54879-20-8 Purity
96%
Inquiry Basket
2,4-Dibromobutanoyl chloride
CAS
82820-87-9
Catalog Number
ACM82820879
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2,4-Dibromobutanoyl chloride?
The molecular formula of 2,4-Dibromobutanoyl chloride is C4H5Br2ClO.
What are some synonyms for 2,4-Dibromobutanoyl chloride?
Some synonyms for 2,4-Dibromobutanoyl chloride are 2,4-Dibromobutyryl chloride and 2,4-dibromobutyrylchloride.
What is the molecular weight of 2,4-Dibromobutanoyl chloride?
The molecular weight of 2,4-Dibromobutanoyl chloride is 264.34 g/mol.
What is the IUPAC name of 2,4-Dibromobutanoyl chloride?
The IUPAC name of 2,4-Dibromobutanoyl chloride is 2,4-dibromobutanoyl chloride.
What is the InChI of 2,4-Dibromobutanoyl chloride?
The InChI of 2,4-Dibromobutanoyl chloride is InChI=1S/C4H5Br2ClO/c5-2-1-3(6)4(7)8/h3H,1-2H2.
What is the InChIKey of 2,4-Dibromobutanoyl chloride?
The InChIKey of 2,4-Dibromobutanoyl chloride is WYZLYWUZERABRL-UHFFFAOYSA-N.
What is the canonical SMILES of 2,4-Dibromobutanoyl chloride?
The canonical SMILES of 2,4-Dibromobutanoyl chloride is C(CBr)C(C(=O)Cl)Br.
What is the CAS number of 2,4-Dibromobutanoyl chloride?
The CAS number of 2,4-Dibromobutanoyl chloride is 82820-87-9.
What is the XLogP3-AA value of 2,4-Dibromobutanoyl chloride?
The XLogP3-AA value of 2,4-Dibromobutanoyl chloride is 2.7.
Is 2,4-Dibromobutanoyl chloride a canonicalized compound?
Yes, 2,4-Dibromobutanoyl chloride is a canonicalized compound.
Recommended Products
