CAS
13959-01-8 Purity
---
13959-01-8 Purity
---
Inquiry Basket
2,4-Dibromo-6-fluoroaniline
CAS
141474-37-5
Catalog Number
ACM141474375
Category
Bromine Series
Molecular Weight
268.91
Molecular Formula
C6H4Br2FN
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2,4-dibromo-6-fluoroaniline?
The molecular formula of 2,4-dibromo-6-fluoroaniline is C6H4Br2FN.
What are the synonyms of 2,4-dibromo-6-fluoroaniline?
The synonyms of 2,4-dibromo-6-fluoroaniline include 141474-37-5, Benzenamine, 2,4-dibromo-6-fluoro-, MFCD00042230, and 2,4-dibromo-6-fluoro aniline.
What is the molecular weight of 2,4-dibromo-6-fluoroaniline?
The molecular weight of 2,4-dibromo-6-fluoroaniline is 268.91 g/mol.
What is the IUPAC name of 2,4-dibromo-6-fluoroaniline?
The IUPAC name of 2,4-dibromo-6-fluoroaniline is 2,4-dibromo-6-fluoroaniline.
What is the InChI of 2,4-dibromo-6-fluoroaniline?
The InChI of 2,4-dibromo-6-fluoroaniline is InChI=1S/C6H4Br2FN/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2.
What is the InChIKey of 2,4-dibromo-6-fluoroaniline?
The InChIKey of 2,4-dibromo-6-fluoroaniline is YJLXEKFYZIBUPJ-UHFFFAOYSA-N.
What is the canonical SMILES of 2,4-dibromo-6-fluoroaniline?
The canonical SMILES of 2,4-dibromo-6-fluoroaniline is C1=C(C=C(C(=C1F)N)Br)Br.
What is the hydrogen bond donor count of 2,4-dibromo-6-fluoroaniline?
The hydrogen bond donor count of 2,4-dibromo-6-fluoroaniline is 1.
What is the hydrogen bond acceptor count of 2,4-dibromo-6-fluoroaniline?
The hydrogen bond acceptor count of 2,4-dibromo-6-fluoroaniline is 2.
Is 2,4-dibromo-6-fluoroaniline a canonicalized compound?
Yes, 2,4-dibromo-6-fluoroaniline is a canonicalized compound.
Recommended Products
