CAS
--- Purity
---
--- Purity
---
Inquiry Basket
2-(4-Chlorophenoxy)nicotinamide
Catalog Number
ACMA00002308
Category
Ethers
Molecular Weight
248.67
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H319
RIDADR
NONH for all modes of transport
Symbol
GHS07
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-(4-chlorophenoxy)pyridine-3-carboxamide.
What is the molecular weight of the compound?
The molecular weight of the compound is 248.66 g/mol.
What is the InChIKey of the compound?
The InChIKey of the compound is CBSIEDJQUZNDOY-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1=CC(=C(N=C1)OC2=CC=C(C=C2)Cl)C(=O)N.
What is the CAS number of the compound?
The CAS number of the compound is 175135-80-5.
What is the European Community (EC) number of the compound?
The European Community (EC) number of the compound is 803-351-5.
What is the ChEMBL ID of the compound?
The ChEMBL ID of the compound is CHEMBL1374304.
What is the DSSTox Substance ID of the compound?
The DSSTox Substance ID of the compound is DTXSID00379263.
What is the Nikkaji Number of the compound?
The Nikkaji Number of the compound is J3.505.464B.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 65.2Ų.
Recommended Products
![7-(4-Methoxyphenyl)[1,2,4]triazolo[1,5-a]pyrimidin-2-amine](/v2/images/structure-default.jpg)
